| Name | 3,3-Dimethylacryloyl chloride |
| Synonyms | SENECIOYL CHLORIDE Methyl-3,3-Dimethyl 3-methyl-2-butenoylchlorid 3-Methylcrotonoyl chloride 3-METHYLCROTONOYL CHLORIDE 3-methylbut-2-enoyl chloride 3-METHYL-2-BUTENOYL CHLORIDE 3,3-Dimethylacryloyl chloride 3,3-DIMETHYLACRYLOYL CHLORIDE 3,3-Dimethylaclyloyl chloride 3-METHYL-BUT-2-ENOYL CHLORIDE |
| CAS | 3350-78-5 |
| EINECS | 222-109-4 |
| InChI | InChI=1/C5H7ClO/c1-4(2)3-5(6)7/h3H,1-2H3 |
| InChIKey | BDUBTLFQHNYXPC-UHFFFAOYSA-N |
| Molecular Formula | C5H7ClO |
| Molar Mass | 118.56 |
| Density | 1.065g/mLat 25°C(lit.) |
| Boling Point | 145-147°C(lit.) |
| Flash Point | 124°F |
| Water Solubility | reacts |
| Vapor Presure | 4.73mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear colorless to yellow |
| BRN | 1560268 |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.476(lit.) |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | R14 - Reacts violently with water R34 - Causes burns R36/37 - Irritating to eyes and respiratory system. R10 - Flammable |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S16 - Keep away from sources of ignition. |
| UN IDs | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-19 |
| HS Code | 29161900 |
| Hazard Class | 3.2 |
| Packing Group | III |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |